Compound Q&A

How is Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate (CAS: 1181267-30-0) typically synthesized?

Answer

Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate
The compound is typically synthesized through a multi-step process involving the coupling of a sulfonyl chloride with a substituted phenol. The reaction is catalyzed by a phase-transfer catalyst, and the product is isolated through column chromatography. The yield is moderate, around 70%, and the reaction is selective for the desired product.

About

English Name Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate
Molecular Formula C20H24O5S
Molecular Weight 376.47 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OCCC2=CC=C(C=C2)C(C)(C)C(=O)OC
InChIKey ILCKTEFFKTZBLQ-UHFFFAOYSA-N
Last Updated: 2026-03-01 18:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate (CAS: 1181267-30-0)?

The compound is a crystalline solid with a molecular weight of approximately 414.47 g/mol. It has li...

Compound Q&A

What industries use Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate (CAS: 1181267-30-0)?

This compound is primarily used in the pharmaceutical industry for its potential as a precursor in t...

Compound Q&A

What precautions should be taken when handling Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate (CAS: 1181267-30-0)?

When handling this compound, it is crucial to use personal protective equipment (PPE) such as gloves...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...