Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3)?

Answer

Methyl 5-bromo-4-chloro-2-methoxybenzoate
When handling Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be handled in a well-ventilated area, ideally in a fume hood. Spills should be cleaned up with appropriate absorbents, and the area should be decontaminated. A safety data sheet (SDS) should be consulted for specific handling and disposal guidelines.

About

English Name Methyl 5-bromo-4-chloro-2-methoxybenzoate
Molecular Formula C9H8BrClO3
Molecular Weight 279.52 g/mol
SMILES COC1=CC(=C(C=C1C(=O)OC)Br)Cl
InChIKey PEPILDJCUDNKGU-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3)?

Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) is a crystalline solid with a molecular...

Compound Q&A

How is Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) typically synthesized?

Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) is typically synthesized via a brominat...

Compound Q&A

What industries use Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3)?

Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) is primarily used in the pharmaceutical...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...