Compound Q&A

What industries use Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3)?

Answer

Methyl 5-bromo-4-chloro-2-methoxybenzoate
Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) is primarily used in the pharmaceutical industry for the synthesis of drug intermediates. It is also utilized in the polymer industry for the development of specialized polymers. Additionally, it has applications in the production of certain sensors and in the semiconductor industry for specific chemical treatments.

About

English Name Methyl 5-bromo-4-chloro-2-methoxybenzoate
Molecular Formula C9H8BrClO3
Molecular Weight 279.52 g/mol
SMILES COC1=CC(=C(C=C1C(=O)OC)Br)Cl
InChIKey PEPILDJCUDNKGU-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3)?

Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) is a crystalline solid with a molecular...

Compound Q&A

How is Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) typically synthesized?

Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) is typically synthesized via a brominat...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3)?

When handling Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3), it is essential to use p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...