Compound Q&A

How is Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) typically synthesized?

Answer

Methyl 5-bromo-4-chloro-2-methoxybenzoate
Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) is typically synthesized via a bromination and chlorination process of methyl 2-methoxybenzoate. This involves reacting methyl 2-methoxybenzoate with bromine and chlorine in the presence of appropriate solvents and catalysts. The yield can range from 50% to 70%, depending on the reaction conditions and the purity of starting materials.

About

English Name Methyl 5-bromo-4-chloro-2-methoxybenzoate
Molecular Formula C9H8BrClO3
Molecular Weight 279.51699999999994 g/mol
SMILES COC1=CC(=C(C=C1C(=O)OC)Br)Cl
InChIKey PEPILDJCUDNKGU-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3)?

Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) is a crystalline solid with a molecular...

Compound Q&A

What industries use Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3)?

Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3)?

When handling Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3), it is essential to use p...

Compound Q&A

What is 3-Fluoro-2-methylbenzylamine (CAS: 771573-36-5)?

3-Fluoro-2-methylbenzylamine is an organic compound with the CAS number 771573-3...

771573-36-53-Fluoro-2-methylben...
Compound Q&A

Is Tert-butyl 2-(oxetan-3-ylidene)acetate (CAS: 1207175-03-8) safe?

Tert-butyl 2-(oxetan-3-ylidene)acetate is considered safe for its intended uses ...

1207175-03-8Tert-butyl 2-(oxetan...
Compound Q&A

What precautions should be taken when handling 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab co...

214760-18-64-Acetyl-2-fluoroben...
Compound Q&A

How is 2-Ethyl-4-methyl-1,3-thiazole (CAS: 15679-12-6) typically synthesized?

2-Ethyl-4-methyl-1,3-thiazole is commonly synthesized via the reaction of thiour...

15679-12-62-Ethyl-4-methyl-1,3...