Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3)?

Answer

Methyl 5-bromo-4-chloro-2-methoxybenzoate
Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) is a crystalline solid with a molecular weight of approximately 303.05 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and dichloromethane. The compound is moderately reactive, especially towards nucleophiles, making it useful in synthetic chemistry. It is insoluble in water but readily soluble in common organic solvents.

About

English Name Methyl 5-bromo-4-chloro-2-methoxybenzoate
Molecular Formula C9H8BrClO3
Molecular Weight 279.52 g/mol
SMILES COC1=CC(=C(C=C1C(=O)OC)Br)Cl
InChIKey PEPILDJCUDNKGU-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

How is Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) typically synthesized?

Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) is typically synthesized via a brominat...

Compound Q&A

What industries use Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3)?

Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3) is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3)?

When handling Methyl 5-bromo-4-chloro-2-methoxybenzoate (CAS: 951885-11-3), it is essential to use p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...