Compound Q&A

What industries use 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside (CAS: 76947-60-9)?

Answer

2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside
This compound is used in the pharmaceutical industry for its potential as a precursor in drug synthesis. It also finds applications in the polymer industry as a component in the development of smart materials and in the electronics industry as a precursor in the fabrication of organic semiconductors.

About

CAS No 76947-60-9
English Name 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside
Molecular Formula C21H30O8
Molecular Weight 410.463 g/mol
SMILES CC1=C(C(=C(C2=C1C(=O)C(C2)(C)C)O)C)CCOC3C(C(C(C(O3)CO)O)O)O
InChIKey IXDYXCFZRYXQBB-JQAJVKEVSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside (CAS: 76947-60-9)?

The compound has a crystalline form with a molecular weight of approximately 528.63 g/mol. It has a ...

Compound Q&A

How is 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside (CAS: 76947-60-9) typically synthesized?

This compound is typically synthesized through a multistep process involving condensation reactions ...

Compound Q&A

What precautions should be taken when handling 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside (CAS: 76947-60-9)?

When handling this compound, it is crucial to use personal protective equipment (PPE) such as gloves...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...