Compound Q&A

What are the physical and chemical properties of 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside (CAS: 76947-60-9)?

Answer

2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside
The compound has a crystalline form with a molecular weight of approximately 528.63 g/mol. It has a low water solubility, making it challenging to dissolve in water. Chemically, it is moderately reactive, particularly towards nucleophilic substitution reactions. Its stability under various conditions is good, but it should be stored away from moisture and heat.

About

CAS No 76947-60-9
English Name 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside
Molecular Formula C21H30O8
Molecular Weight 410.463 g/mol
SMILES CC1=C(C(=C(C2=C1C(=O)C(C2)(C)C)O)C)CCOC3C(C(C(C(O3)CO)O)O)O
InChIKey IXDYXCFZRYXQBB-JQAJVKEVSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

How is 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside (CAS: 76947-60-9) typically synthesized?

This compound is typically synthesized through a multistep process involving condensation reactions ...

Compound Q&A

What industries use 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside (CAS: 76947-60-9)?

This compound is used in the pharmaceutical industry for its potential as a precursor in drug synthe...

Compound Q&A

What precautions should be taken when handling 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside (CAS: 76947-60-9)?

When handling this compound, it is crucial to use personal protective equipment (PPE) such as gloves...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...