Compound Q&A

How is 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside (CAS: 76947-60-9) typically synthesized?

Answer

2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside
This compound is typically synthesized through a multistep process involving condensation reactions and catalytic hydrogenation. Commonly used catalysts include palladium on carbon. The synthesis involves protecting the hydroxyl group, followed by coupling reactions and subsequent deprotection to obtain the desired product with high selectivity and yield.

About

CAS No 76947-60-9
English Name 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside
Molecular Formula C21H30O8
Molecular Weight 410.463 g/mol
SMILES CC1=C(C(=C(C2=C1C(=O)C(C2)(C)C)O)C)CCOC3C(C(C(C(O3)CO)O)O)O
InChIKey IXDYXCFZRYXQBB-JQAJVKEVSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside (CAS: 76947-60-9)?

The compound has a crystalline form with a molecular weight of approximately 528.63 g/mol. It has a ...

Compound Q&A

What industries use 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside (CAS: 76947-60-9)?

This compound is used in the pharmaceutical industry for its potential as a precursor in drug synthe...

Compound Q&A

What precautions should be taken when handling 2-(7-Hydroxy-2,2,4,6-tetramethyl-3-oxo-2,3-dihydro-1H-inden-5-yl)ethyl beta-D-glucopyranoside (CAS: 76947-60-9)?

When handling this compound, it is crucial to use personal protective equipment (PPE) such as gloves...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...