Compound Q&A

What are the physical and chemical properties of 2-Chloro-7-methoxy-3-methylquinoline (CAS: 132118-45-7)?

Answer

2-Chloro-7-methoxy-3-methylquinoline
2-Chloro-7-methoxy-3-methylquinoline is a crystalline solid with a molecular weight of approximately 261.67 g/mol. It has a high melting point of around 175-177°C. The compound is slightly soluble in water but readily soluble in organic solvents such as ethanol and acetone. Chemically, it is less reactive compared to other quinoline derivatives but can undergo electrophilic aromatic substitution reactions easily. It is often used in the synthesis of pharmaceuticals and other organic compounds.

About

English Name 2-Chloro-7-methoxy-3-methylquinoline
Molecular Formula C11H10ClNO
Molecular Weight 207.66 g/mol
SMILES CC1=CC2=C(C=C(C=C2)OC)N=C1Cl
InChIKey KVBVZTHTUJBHOF-UHFFFAOYSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

How is 2-Chloro-7-methoxy-3-methylquinoline (CAS: 132118-45-7) typically synthesized?

2-Chloro-7-methoxy-3-methylquinoline is typically synthesized via the Friedel-Crafts alkylation of 7...

Compound Q&A

What industries use 2-Chloro-7-methoxy-3-methylquinoline (CAS: 132118-45-7)?

2-Chloro-7-methoxy-3-methylquinoline is primarily used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 2-Chloro-7-methoxy-3-methylquinoline (CAS: 132118-45-7)?

When handling 2-Chloro-7-methoxy-3-methylquinoline, safety goggles, gloves, and lab coats should be ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...