Compound Q&A

What precautions should be taken when handling Amikacin EP Impurity B (CAS: 927821-99-6)?

Answer

Amikacin EP Impurity B
When handling Amikacin EP Impurity B, it is crucial to use appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be flushed with water. Always refer to the Safety Data Sheet (SDS) for specific handling and disposal guidelines.

About

English Name Amikacin EP Impurity B
Molecular Formula C26H50N6O15
Molecular Weight 686.71 g/mol
SMILES C1C(C(C(C(C1NC(=O)C(CCN)O)OC2C(C(C(C(O2)CN)O)O)O)O)OC3C(C(C(C(O3)CO)O)N)O)NC(=O)C(CCN)O
InChIKey HVNATBKIPCIZAA-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Amikacin EP Impurity B (CAS: 927821-99-6)?

Amikacin EP Impurity B is a white or off-white crystalline powder. Its molecular weight is approxima...

Compound Q&A

How is Amikacin EP Impurity B (CAS: 927821-99-6) typically synthesized?

Amikacin EP Impurity B is synthesized through a series of chemical reactions starting from amikacin ...

Compound Q&A

What industries use Amikacin EP Impurity B (CAS: 927821-99-6)?

Amikacin EP Impurity B, though not a pure compound itself, is often used in the pharmaceutical indus...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...