Compound Q&A

What industries use Amikacin EP Impurity B (CAS: 927821-99-6)?

Answer

Amikacin EP Impurity B
Amikacin EP Impurity B, though not a pure compound itself, is often used in the pharmaceutical industry as a reference material for quality control and impurity profiling. It is also relevant in academic research for studying the properties and behavior of amikacin and its derivatives. In the pharmaceutical sector, it aids in the development and assessment of amikacin-based drugs.

About

English Name Amikacin EP Impurity B
Molecular Formula C26H50N6O15
Molecular Weight 686.71 g/mol
SMILES C1C(C(C(C(C1NC(=O)C(CCN)O)OC2C(C(C(C(O2)CN)O)O)O)O)OC3C(C(C(C(O3)CO)O)N)O)NC(=O)C(CCN)O
InChIKey HVNATBKIPCIZAA-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Amikacin EP Impurity B (CAS: 927821-99-6)?

Amikacin EP Impurity B is a white or off-white crystalline powder. Its molecular weight is approxima...

Compound Q&A

How is Amikacin EP Impurity B (CAS: 927821-99-6) typically synthesized?

Amikacin EP Impurity B is synthesized through a series of chemical reactions starting from amikacin ...

Compound Q&A

What precautions should be taken when handling Amikacin EP Impurity B (CAS: 927821-99-6)?

When handling Amikacin EP Impurity B, it is crucial to use appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...