Compound Q&A

What precautions should be taken when handling 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8)?

Answer

1,5-Dimethyl-4-nitroimidazole
When handling 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8), it is important to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. The compound should be used in a well-ventilated area or a fume hood due to its potential for release of toxic fumes. Spills should be handled carefully using absorbent materials and the area should be thoroughly cleaned. Always refer to the safety data sheet (SDS) for specific guidelines and emergency procedures.

About

CAS No 7464-68-8
English Name 1,5-Dimethyl-4-nitroimidazole
Molecular Formula C5H7N3O2
Molecular Weight 141.13 g/mol
SMILES CC1=C(N=CN1C)[N+](=O)[O-]
InChIKey ULEIQLOXYAULFE-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8)?

1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8) is a crystalline solid with a molecular weight of 178...

Compound Q&A

How is 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8) typically synthesized?

1,5-Dimethyl-4-nitroimidazole is typically synthesized through the nitration of 1,5-dimethylimidazol...

Compound Q&A

What industries use 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8)?

1,5-Dimethyl-4-nitroimidazole finds applications in various industries. In the pharmaceutical sector...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...