Compound Q&A

What industries use 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8)?

Answer

1,5-Dimethyl-4-nitroimidazole
1,5-Dimethyl-4-nitroimidazole finds applications in various industries. In the pharmaceutical sector, it serves as a precursor for the synthesis of drugs. It is also used in the production of sensors due to its ability to interact with specific gases. Additionally, it has applications in the polymer industry for the development of new materials and in the semiconductor industry for its potential as a dopant.

About

CAS No 7464-68-8
English Name 1,5-Dimethyl-4-nitroimidazole
Molecular Formula C5H7N3O2
Molecular Weight 141.13 g/mol
SMILES CC1=C(N=CN1C)[N+](=O)[O-]
InChIKey ULEIQLOXYAULFE-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8)?

1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8) is a crystalline solid with a molecular weight of 178...

Compound Q&A

How is 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8) typically synthesized?

1,5-Dimethyl-4-nitroimidazole is typically synthesized through the nitration of 1,5-dimethylimidazol...

Compound Q&A

What precautions should be taken when handling 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8)?

When handling 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8), it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...