Compound Q&A

What are the physical and chemical properties of 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8)?

Answer

1,5-Dimethyl-4-nitroimidazole
1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8) is a crystalline solid with a molecular weight of 178.12 g/mol. It has a melting point of 122-124°C and is slightly soluble in water. This compound is moderately reactive, especially under acidic or basic conditions, and it decomposes when heated above 140°C. It is also susceptible to hydrolysis in aqueous solutions.

About

CAS No 7464-68-8
English Name 1,5-Dimethyl-4-nitroimidazole
Molecular Formula C5H7N3O2
Molecular Weight 141.13 g/mol
SMILES CC1=C(N=CN1C)[N+](=O)[O-]
InChIKey ULEIQLOXYAULFE-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

How is 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8) typically synthesized?

1,5-Dimethyl-4-nitroimidazole is typically synthesized through the nitration of 1,5-dimethylimidazol...

Compound Q&A

What industries use 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8)?

1,5-Dimethyl-4-nitroimidazole finds applications in various industries. In the pharmaceutical sector...

Compound Q&A

What precautions should be taken when handling 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8)?

When handling 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8), it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...