Compound Q&A

How is 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8) typically synthesized?

Answer

1,5-Dimethyl-4-nitroimidazole
1,5-Dimethyl-4-nitroimidazole is typically synthesized through the nitration of 1,5-dimethylimidazole. The nitration process involves the use of concentrated nitric acid and sulfuric acid as the nitrating agent. The reaction is carried out at low temperature, and the product can be isolated by recrystallization. The yield is generally around 70-80%, and the process requires careful control of temperature and concentration to ensure selectivity.

About

CAS No 7464-68-8
English Name 1,5-Dimethyl-4-nitroimidazole
Molecular Formula C5H7N3O2
Molecular Weight 141.13 g/mol
SMILES CC1=C(N=CN1C)[N+](=O)[O-]
InChIKey ULEIQLOXYAULFE-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8)?

1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8) is a crystalline solid with a molecular weight of 178...

Compound Q&A

What industries use 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8)?

1,5-Dimethyl-4-nitroimidazole finds applications in various industries. In the pharmaceutical sector...

Compound Q&A

What precautions should be taken when handling 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8)?

When handling 1,5-Dimethyl-4-nitroimidazole (CAS: 7464-68-8), it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...