Compound Q&A

What industries use 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6)?

Answer

4-Acetamido-2-bromo-5-nitroanisole
4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6) is primarily used in the pharmaceutical industry as an intermediate for the synthesis of various drug candidates. It also finds applications in the polymer industry for the development of novel materials with specific chemical functionalities. Additionally, this compound can be utilized in sensor technology for detecting certain chemical species and in semiconductor manufacturing as a dopant material.

About

CAS No 7357-66-6
English Name 4-Acetamido-2-bromo-5-nitroanisole
Molecular Formula C9H9BrN2O4
Molecular Weight 289.08 g/mol
SMILES CC(=O)NC1=CC(=C(C=C1[N+](=O)[O-])OC)Br
InChIKey WFVRYIASUVEKMY-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6)?

4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6) is a crystalline compound with a molecular weigh...

Compound Q&A

How is 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6) typically synthesized?

4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6) can be synthesized through a multi-step process ...

Compound Q&A

What precautions should be taken when handling 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6)?

When handling 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...