Compound Q&A

What are the physical and chemical properties of 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6)?

Answer

4-Acetamido-2-bromo-5-nitroanisole
4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6) is a crystalline compound with a molecular weight of 298.01 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and dichloromethane. This compound is known for its reactivity in nucleophilic aromatic substitution reactions due to the presence of a bromine atom and nitro group. It also exhibits good stability under neutral and slightly acidic conditions, but can be sensitive to strong bases and reducing agents.

About

CAS No 7357-66-6
English Name 4-Acetamido-2-bromo-5-nitroanisole
Molecular Formula C9H9BrN2O4
Molecular Weight 289.08 g/mol
SMILES CC(=O)NC1=CC(=C(C=C1[N+](=O)[O-])OC)Br
InChIKey WFVRYIASUVEKMY-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:11

Related Q&A

Compound Q&A

How is 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6) typically synthesized?

4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6) can be synthesized through a multi-step process ...

Compound Q&A

What industries use 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6)?

4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6)?

When handling 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...