Compound Q&A

How is 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6) typically synthesized?

Answer

4-Acetamido-2-bromo-5-nitroanisole
4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6) can be synthesized through a multi-step process that involves the bromination of anisole followed by nitration and acetylation. The bromination step typically uses N-bromosuccinimide (NBS) in the presence of a peroxide initiator. Nitration is performed using fuming nitric acid and sulfuric acid. The acetylation is achieved using acetic anhydride or acetyl chloride in the presence of a catalyst. These reactions require precise control of conditions to achieve high yield and selectivity.

About

CAS No 7357-66-6
English Name 4-Acetamido-2-bromo-5-nitroanisole
Molecular Formula C9H9BrN2O4
Molecular Weight 289.08 g/mol
SMILES CC(=O)NC1=CC(=C(C=C1[N+](=O)[O-])OC)Br
InChIKey WFVRYIASUVEKMY-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6)?

4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6) is a crystalline compound with a molecular weigh...

Compound Q&A

What industries use 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6)?

4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6)?

When handling 4-Acetamido-2-bromo-5-nitroanisole (CAS: 7357-66-6), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...