Compound Q&A

What industries use 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate (CAS: 781649-86-3)?

Answer

2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate is primarily used in the pharmaceutical industry, where it serves as a key intermediate in the synthesis of various medicinals. It is also of interest in the polymer industry for its potential to improve material properties, and in the sensor and semiconductor industries due to its functional groups.

About

English Name 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate
Molecular Formula C15H24N4O2
Molecular Weight 292.38 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)NC2=C(N=CC=C2)N
InChIKey NRYFFLQIEZSPBO-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate (CAS: 781649-86-3)?

2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate is a crystalline compound...

Compound Q&A

How is 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate (CAS: 781649-86-3) typically synthesized?

2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate is commonly synthesized u...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate (CAS: 781649-86-3)?

When handling 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate, it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...