Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate (CAS: 781649-86-3)?

Answer

2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate is a crystalline compound with a molecular weight of approximately 339.36 g/mol. It has a high solubility in organic solvents like methanol and ethyl acetate. The compound exhibits moderate reactivity, especially towards nucleophiles and is typically stable under normal storage conditions. Due to its functional groups, it can participate in various chemical reactions, including esterification and condensation reactions.

About

English Name 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate
Molecular Formula C15H24N4O2
Molecular Weight 292.38 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)NC2=C(N=CC=C2)N
InChIKey NRYFFLQIEZSPBO-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate (CAS: 781649-86-3) typically synthesized?

2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate is commonly synthesized u...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate (CAS: 781649-86-3)?

2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate is primarily used in the ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate (CAS: 781649-86-3)?

When handling 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate, it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...