Compound Q&A

How is 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate (CAS: 781649-86-3) typically synthesized?

Answer

2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate is commonly synthesized using a multi-step process involving the condensation of a pyridine derivative with a piperidine carboxylic acid ester. The synthesis typically employs catalytic amounts of a Lewis acid such as aluminum chloride. The method ensures high yield and good selectivity, making it a suitable route for commercial production.

About

English Name 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate
Molecular Formula C15H24N4O2
Molecular Weight 292.38 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)NC2=C(N=CC=C2)N
InChIKey NRYFFLQIEZSPBO-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate (CAS: 781649-86-3)?

2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate is a crystalline compound...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate (CAS: 781649-86-3)?

2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate is primarily used in the ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate (CAS: 781649-86-3)?

When handling 2-Methyl-2-propanyl 4-[(2-amino-3-pyridinyl)amino]-1-piperidinecarboxylate, it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...