Compound Q&A

What precautions should be taken when handling 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6)?

Answer

6-(3-Aminophenyl)picolinic acid
When handling 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6), it is important to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure to the compound. Spills should be cleaned up using appropriate absorbent materials and disposed of according to local regulations. Always refer to the Safety Data Sheet (SDS) for specific handling instructions and emergency procedures.

About

English Name 6-(3-Aminophenyl)picolinic acid
Molecular Formula C12H10N2O2
Molecular Weight 214.22 g/mol
SMILES C1=CC(=CC(=C1)N)C2=NC(=CC=C2)C(=O)O
InChIKey APPZUWSRWDJQDL-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6)?

6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6) is a crystalline solid with a molecular weight o...

Compound Q&A

How is 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6) typically synthesized?

6-(3-Aminophenyl)picolinic acid can be synthesized through a multi-step process. One common approach...

Compound Q&A

What industries use 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6)?

6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6) is primarily used in pharmaceuticals for its pot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...