Compound Q&A

What are the physical and chemical properties of 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6)?

Answer

6-(3-Aminophenyl)picolinic acid
6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6) is a crystalline solid with a molecular weight of approximately 231.23 g/mol. It is slightly soluble in water and organic solvents. Chemically, it is moderately reactive, particularly with nucleophiles due to the amine group. It exhibits good solubility in polar solvents such as methanol and ethanol. This compound is stable under normal storage conditions but may degrade under acidic or basic conditions.

About

English Name 6-(3-Aminophenyl)picolinic acid
Molecular Formula C12H10N2O2
Molecular Weight 214.22 g/mol
SMILES C1=CC(=CC(=C1)N)C2=NC(=CC=C2)C(=O)O
InChIKey APPZUWSRWDJQDL-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

How is 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6) typically synthesized?

6-(3-Aminophenyl)picolinic acid can be synthesized through a multi-step process. One common approach...

Compound Q&A

What industries use 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6)?

6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6) is primarily used in pharmaceuticals for its pot...

Compound Q&A

What precautions should be taken when handling 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6)?

When handling 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6), it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...