Compound Q&A

What industries use 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6)?

Answer

6-(3-Aminophenyl)picolinic acid
6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6) is primarily used in pharmaceuticals for its potential as an antimicrobial agent and for its role in the development of new drugs. It also finds application in the chemical industry for the synthesis of other compounds and in research for its biological activities. Additionally, it may be used in some sensor technologies and materials science for its reactive functional groups.

About

English Name 6-(3-Aminophenyl)picolinic acid
Molecular Formula C12H10N2O2
Molecular Weight 214.22 g/mol
SMILES C1=CC(=CC(=C1)N)C2=NC(=CC=C2)C(=O)O
InChIKey APPZUWSRWDJQDL-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6)?

6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6) is a crystalline solid with a molecular weight o...

Compound Q&A

How is 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6) typically synthesized?

6-(3-Aminophenyl)picolinic acid can be synthesized through a multi-step process. One common approach...

Compound Q&A

What precautions should be taken when handling 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6)?

When handling 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6), it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...