Compound Q&A

How is 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6) typically synthesized?

Answer

6-(3-Aminophenyl)picolinic acid
6-(3-Aminophenyl)picolinic acid can be synthesized through a multi-step process. One common approach involves the reaction of 3-aminophenylamine with picolinoyl chloride in the presence of a base such as triethylamine. This reaction typically yields a racemic mixture. Further purification and separation techniques, such as recrystallization or chromatography, may be required to obtain the desired enantiomeric form. The yield is generally around 70-80%.

About

English Name 6-(3-Aminophenyl)picolinic acid
Molecular Formula C12H10N2O2
Molecular Weight 214.22 g/mol
SMILES C1=CC(=CC(=C1)N)C2=NC(=CC=C2)C(=O)O
InChIKey APPZUWSRWDJQDL-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6)?

6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6) is a crystalline solid with a molecular weight o...

Compound Q&A

What industries use 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6)?

6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6) is primarily used in pharmaceuticals for its pot...

Compound Q&A

What precautions should be taken when handling 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6)?

When handling 6-(3-Aminophenyl)picolinic acid (CAS: 1261925-21-6), it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...