Compound Q&A

How should Alisporivir (CAS: 254435-95-5) be stored?

Answer

Alisporivir
Alisporivir (CAS: 254435-95-5) should be stored at room temperature (15-30°C or 59-86°F), away from direct sunlight and moisture. The medication should be kept in a tightly closed container, preferably a child-resistant bottle. It is advisable to keep the medication out of reach of children and pets. Do not expose the drug to extreme temperatures or store it in damp conditions.

About

English Name Alisporivir
Molecular Formula C63H113N11O12
Molecular Weight 1216.6619999999982 g/mol
SMILES CCC1C(=O)N(C(C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N1)C(C(C)CC=CC)O)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)C(C)C)CC)C)C
InChIKey OLROWHGDTNFZBH-XEMWPYQTSA-N
Last Updated: 2026-01-09 10:47

Related Q&A

Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment of hepatitis B virus...

Compound Q&A

What are the main uses of Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is primarily used for the treatment of chronic hepatitis B virus (HBV...

Compound Q&A

Is Alisporivir (CAS: 254435-95-5) safe?

Alisporivir (CAS: 254435-95-5) is generally considered safe when used under the guidance of a health...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...