Compound Q&A

Is Alisporivir (CAS: 254435-95-5) safe?

Answer

Alisporivir
Alisporivir (CAS: 254435-95-5) is generally considered safe when used under the guidance of a healthcare professional. However, like all medications, it may cause side effects such as nausea, headache, and skin rash. Patients should avoid driving or operating heavy machinery if experiencing dizziness or drowsiness. It is important to follow the prescribed dosage and consult a doctor if any adverse effects occur.

About

English Name Alisporivir
Molecular Formula C63H113N11O12
Molecular Weight 1216.6619999999982 g/mol
SMILES CCC1C(=O)N(C(C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N1)C(C(C)CC=CC)O)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)C(C)C)CC)C)C
InChIKey OLROWHGDTNFZBH-XEMWPYQTSA-N
Last Updated: 2026-01-09 10:47

Related Q&A

Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment of hepatitis B virus...

Compound Q&A

What are the main uses of Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is primarily used for the treatment of chronic hepatitis B virus (HBV...

Compound Q&A

How should Alisporivir (CAS: 254435-95-5) be stored?

Alisporivir (CAS: 254435-95-5) should be stored at room temperature (15-30°C or 59-86°F), away from ...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...