Compound Q&A

What precautions should be taken when handling 5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride (CAS: 324077-30-7)?

Answer

5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol;hydrochloride
When handling 5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride, it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. The compound should be used in a well-ventilated area or a fume hood to minimize inhalation risks. In case of spills, immediately clean up using appropriate absorbent materials and ensure proper disposal of waste. Always refer to the Safety Data Sheet (SDS) for detailed instructions on handling and storage.

About

English Name 5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol;hydrochloride
Molecular Formula C22H19ClFN3O2
Molecular Weight 411.86 g/mol
SMILES Cc1cc(c(cc1O)Nc2c3ccc(cc3ncn2)OCc4ccccc4)F.Cl
InChIKey AVRHWGLIYGJSOD-UHFFFAOYSA-N
Last Updated: 2026-01-08 21:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride (CAS: 324077-30-7)?

5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride is a crystalline compou...

Compound Q&A

How is 5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride (CAS: 324077-30-7) typically synthesized?

5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride is typically synthesize...

Compound Q&A

What industries use 5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride (CAS: 324077-30-7)?

5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride is primarily used in th...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...