Compound Q&A

What are the physical and chemical properties of 5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride (CAS: 324077-30-7)?

Answer

5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol;hydrochloride
5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride is a crystalline compound with a molecular weight of approximately 529.8 g/mol. It is poorly soluble in water but soluble in organic solvents like methanol and ethanol. This compound exhibits low reactivity under normal conditions but can undergo substitution reactions in the presence of appropriate reagents. Its hydrochloride salt form is commonly used in pharmaceutical applications due to its stability and solubility properties.

About

English Name 5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol;hydrochloride
Molecular Formula C22H19ClFN3O2
Molecular Weight 411.86 g/mol
SMILES Cc1cc(c(cc1O)Nc2c3ccc(cc3ncn2)OCc4ccccc4)F.Cl
InChIKey AVRHWGLIYGJSOD-UHFFFAOYSA-N
Last Updated: 2026-01-08 21:12

Related Q&A

Compound Q&A

How is 5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride (CAS: 324077-30-7) typically synthesized?

5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride is typically synthesize...

Compound Q&A

What industries use 5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride (CAS: 324077-30-7)?

5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride is primarily used in th...

Compound Q&A

What precautions should be taken when handling 5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride (CAS: 324077-30-7)?

When handling 5-[(7-benzyloxyquinazolin-4-yl)amino]-4-fluoro-2-methyl-phenol hydrochloride, it is es...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...