Compound Q&A

What industries use 2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0)?

Answer

2,3,6-Trichloro-4-(trifluoromethyl)pyridine
2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0) is primarily used in the pharmaceutical industry for the synthesis of certain drugs and in the semiconductor industry for doping materials. It is also used in the production of certain sensors and as a precursor in polymer chemistry.

About

CAS No 81565-20-0
English Name 2,3,6-Trichloro-4-(trifluoromethyl)pyridine
Molecular Formula C6HCl3F3N
Molecular Weight 250.43 g/mol
SMILES C1=C(C(=C(N=C1Cl)Cl)Cl)C(F)(F)F
InChIKey KCMZCZXPLOZOGG-UHFFFAOYSA-N
Last Updated: 2026-01-07 14:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0)?

2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0) is a crystalline solid with a molecula...

Compound Q&A

How is 2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0) typically synthesized?

2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0) is typically synthesized via electroph...

Compound Q&A

What precautions should be taken when handling 2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0)?

When handling 2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0), use personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...