Compound Q&A

How is 2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0) typically synthesized?

Answer

2,3,6-Trichloro-4-(trifluoromethyl)pyridine
2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0) is typically synthesized via electrophilic aromatic substitution reactions involving 4-chloro-2,3,6-trimethylpyridine and trifluoroacetyl chloride. The reaction is carried out in the presence of a Lewis acid catalyst, such as aluminum chloride, to promote the electrophilic reactivity of the trifluoroacetyl chloride.

About

CAS No 81565-20-0
English Name 2,3,6-Trichloro-4-(trifluoromethyl)pyridine
Molecular Formula C6HCl3F3N
Molecular Weight 250.43 g/mol
SMILES C1=C(C(=C(N=C1Cl)Cl)Cl)C(F)(F)F
InChIKey KCMZCZXPLOZOGG-UHFFFAOYSA-N
Last Updated: 2026-01-07 14:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0)?

2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0) is a crystalline solid with a molecula...

Compound Q&A

What industries use 2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0)?

2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0)?

When handling 2,3,6-Trichloro-4-(trifluoromethyl)pyridine (CAS: 81565-20-0), use personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...