Compound Q&A

What precautions should be taken when handling Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7)?

Answer

Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane
When handling Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats. Work should be conducted in a fume hood to minimize inhalation risks. Spills should be cleaned up carefully, and proper safety data sheets (SDS) should be consulted for detailed emergency procedures. Ensure good ventilation and avoid skin contact at all times.

About

CAS No 68092-71-7
English Name Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane
Molecular Formula C11H16Cl2Si
Molecular Weight 247.24 g/mol
EINECS 268-469-6
SMILES ClCC(c1ccccc1)C[Si](Cl)(C)C
InChIKey VJJQWSQPPVXOJA-UHFFFAOYSA-N
Last Updated: 2026-01-07 14:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7)?

Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) is a colorless or pale yello...

Compound Q&A

How is Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) typically synthesized?

Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) is typically synthesized thr...

Compound Q&A

What industries use Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7)?

Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) is used in the pharmaceutica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...