Compound Q&A

What are the physical and chemical properties of Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7)?

Answer

Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane
Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) is a colorless or pale yellow liquid at room temperature. Its molecular weight is approximately 347.6 g/mol. The compound is only slightly soluble in water but is miscible with many organic solvents. It is reactive towards nucleophiles and bases, making it useful as a functional group in synthetic chemistry.

About

CAS No 68092-71-7
English Name Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane
Molecular Formula C11H16Cl2Si
Molecular Weight 247.24 g/mol
EINECS 268-469-6
SMILES ClCC(c1ccccc1)C[Si](Cl)(C)C
InChIKey VJJQWSQPPVXOJA-UHFFFAOYSA-N
Last Updated: 2026-01-07 14:58

Related Q&A

Compound Q&A

How is Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) typically synthesized?

Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) is typically synthesized thr...

Compound Q&A

What industries use Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7)?

Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) is used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7)?

When handling Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7), it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...