Compound Q&A

What industries use Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7)?

Answer

Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane
Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) is used in the pharmaceutical industry for synthesizing various drug molecules. It is also utilized in polymer science for modifying the properties of polymers, in sensor technology for creating sensitive detection devices, and in semiconductor manufacturing for specific etching and cleaning processes.

About

CAS No 68092-71-7
English Name Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane
Molecular Formula C11H16Cl2Si
Molecular Weight 247.24 g/mol
EINECS 268-469-6
SMILES ClCC(c1ccccc1)C[Si](Cl)(C)C
InChIKey VJJQWSQPPVXOJA-UHFFFAOYSA-N
Last Updated: 2026-01-07 14:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7)?

Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) is a colorless or pale yello...

Compound Q&A

How is Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) typically synthesized?

Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) is typically synthesized thr...

Compound Q&A

What precautions should be taken when handling Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7)?

When handling Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7), it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...