Compound Q&A

How is Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) typically synthesized?

Answer

Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane
Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) is typically synthesized through a reaction involving a chloromethylated phenyl compound and dimethyldichlorosilane. The synthesis often requires controlled conditions to achieve high yield and selectivity. Suitable catalysts and solvents are used to ensure the reaction proceeds as intended.

About

CAS No 68092-71-7
English Name Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane
Molecular Formula C11H16Cl2Si
Molecular Weight 247.24 g/mol
EINECS 268-469-6
SMILES ClCC(c1ccccc1)C[Si](Cl)(C)C
InChIKey VJJQWSQPPVXOJA-UHFFFAOYSA-N
Last Updated: 2026-01-07 14:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7)?

Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) is a colorless or pale yello...

Compound Q&A

What industries use Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7)?

Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7) is used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7)?

When handling Chloro{2-[3-(chloromethyl)phenyl]ethyl}dimethylsilane (CAS: 68092-71-7), it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...