Compound Q&A

What are the physical and chemical properties of (S)-Baclofen (CAS: 66514-99-6)?

Answer

(S)-Baclofen
(S)-Baclofen is a colorless to white crystalline powder with a molecular weight of 246.28 g/mol. It is slightly soluble in water and ethanol. Chemically, it is less reactive compared to other amine compounds, but it can undergo hydrolysis under basic conditions. It has a pKa of approximately 7.0.

About

CAS No 66514-99-6
English Name (S)-Baclofen
Molecular Formula C10H12ClNO2
Molecular Weight 213.66 g/mol
SMILES C1=CC(=CC=C1C(CC(=O)O)CN)Cl
InChIKey KPYSYYIEGFHWSV-MRVPVSSYSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

How is (S)-Baclofen (CAS: 66514-99-6) typically synthesized?

(S)-Baclofen is synthesized through the reduction of (S)-2-(1-hydroxyethyl)-1,3-diazepane. This proc...

Compound Q&A

What industries use (S)-Baclofen (CAS: 66514-99-6)?

(S)-Baclofen is primarily used in the pharmaceutical industry as a muscle relaxant and to treat spas...

Compound Q&A

What precautions should be taken when handling (S)-Baclofen (CAS: 66514-99-6)?

When handling (S)-Baclofen, wear appropriate personal protective equipment (PPE) including gloves an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...