Compound Q&A

What precautions should be taken when handling 2-Bromo-5-(chlorosulfonyl)benzoic acid (CAS: 3285-31-2)?

Answer

2-Bromo-5-(chlorosulfonyl)benzoic acid
When handling 2-Bromo-5-(chlorosulfonyl)benzoic acid, it is crucial to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood to minimize exposure to its fumes. Spills should be handled immediately using a suitable absorbent material, and the area should be cleaned with water and detergent. Always refer to the Material Safety Data Sheet (MSDS) for specific safety guidelines.

About

CAS No 3285-31-2
English Name 2-Bromo-5-(chlorosulfonyl)benzoic acid
Molecular Formula C7H4BrClO4S
Molecular Weight 299.53 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)Cl)C(=O)O)Br
InChIKey ZZSQGLFOZUQDAM-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-5-(chlorosulfonyl)benzoic acid (CAS: 3285-31-2)?

2-Bromo-5-(chlorosulfonyl)benzoic acid is a crystalline solid with a molecular weight of approximate...

Compound Q&A

How is 2-Bromo-5-(chlorosulfonyl)benzoic acid (CAS: 3285-31-2) typically synthesized?

2-Bromo-5-(chlorosulfonyl)benzoic acid is typically synthesized through the bromination of 5-chloros...

Compound Q&A

What industries use 2-Bromo-5-(chlorosulfonyl)benzoic acid (CAS: 3285-31-2)?

2-Bromo-5-(chlorosulfonyl)benzoic acid is utilized in various industries, particularly in pharmaceut...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...