Compound Q&A

What industries use 2-Bromo-5-(chlorosulfonyl)benzoic acid (CAS: 3285-31-2)?

Answer

2-Bromo-5-(chlorosulfonyl)benzoic acid
2-Bromo-5-(chlorosulfonyl)benzoic acid is utilized in various industries, particularly in pharmaceuticals for the synthesis of certain medicinal compounds, in the polymer industry for the production of functional polymers, and in the electronics industry for the development of sensors and semiconductor materials.

About

CAS No 3285-31-2
English Name 2-Bromo-5-(chlorosulfonyl)benzoic acid
Molecular Formula C7H4BrClO4S
Molecular Weight 299.53 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)Cl)C(=O)O)Br
InChIKey ZZSQGLFOZUQDAM-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-5-(chlorosulfonyl)benzoic acid (CAS: 3285-31-2)?

2-Bromo-5-(chlorosulfonyl)benzoic acid is a crystalline solid with a molecular weight of approximate...

Compound Q&A

How is 2-Bromo-5-(chlorosulfonyl)benzoic acid (CAS: 3285-31-2) typically synthesized?

2-Bromo-5-(chlorosulfonyl)benzoic acid is typically synthesized through the bromination of 5-chloros...

Compound Q&A

What precautions should be taken when handling 2-Bromo-5-(chlorosulfonyl)benzoic acid (CAS: 3285-31-2)?

When handling 2-Bromo-5-(chlorosulfonyl)benzoic acid, it is crucial to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...