Compound Q&A

What are the physical and chemical properties of 2-Bromo-5-(chlorosulfonyl)benzoic acid (CAS: 3285-31-2)?

Answer

2-Bromo-5-(chlorosulfonyl)benzoic acid
2-Bromo-5-(chlorosulfonyl)benzoic acid is a crystalline solid with a molecular weight of approximately 310.03 g/mol. Its solubility in water is limited, typically around 0.1 g/L at 25°C. The compound is highly reactive due to the presence of the sulfonyl chloride group, which makes it a potent electrophile in nucleophilic substitution reactions. It is insoluble in most organic solvents except for strong polar aprotic solvents like dimethylformamide.

About

CAS No 3285-31-2
English Name 2-Bromo-5-(chlorosulfonyl)benzoic acid
Molecular Formula C7H4BrClO4S
Molecular Weight 299.529 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)Cl)C(=O)O)Br
InChIKey ZZSQGLFOZUQDAM-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

How is 2-Bromo-5-(chlorosulfonyl)benzoic acid (CAS: 3285-31-2) typically synthesized?

2-Bromo-5-(chlorosulfonyl)benzoic acid is typically synthesized through the bromination of 5-chloros...

Compound Q&A

What industries use 2-Bromo-5-(chlorosulfonyl)benzoic acid (CAS: 3285-31-2)?

2-Bromo-5-(chlorosulfonyl)benzoic acid is utilized in various industries, particularly in pharmaceut...

Compound Q&A

What precautions should be taken when handling 2-Bromo-5-(chlorosulfonyl)benzoic acid (CAS: 3285-31-2)?

When handling 2-Bromo-5-(chlorosulfonyl)benzoic acid, it is crucial to wear appropriate personal pro...

Compound Q&A

How should waste containing 2-Ethyl-4-Methyl-1H-Imidazole-5-Carbaldehyde (CAS: 88634-80-4) be handled?

Waste containing 2-Ethyl-4-Methyl-1H-Imidazole-5-Carbaldehyde (CAS: 88634-80-4) ...

88634-80-42-Ethyl-4-Methyl-1H-...
Compound Q&A

What industries use Triethoxy(octyl)silane (CAS: 1385031-14-0)?

Triethoxy(octyl)silane (CAS: 1385031-14-0) is widely used in the pharmaceuticals...

1385031-14-0Triethoxy(octyl)sila...
Compound Q&A

Are there alternatives to 3-iodo-7-nitro-1H-indazole (CAS: 864724-64-1) in synthesis?

Several alternatives to 3-iodo-7-nitro-1H-indazole (CAS: 864724-64-1) exist in t...

864724-64-13-iodo-7-nitro-1H-in...
Compound Q&A

Are there alternatives to Benzene, bis[(trimethoxysilyl)ethyl] (CAS: 266317-71-9) in synthesis?

Yes, there are alternatives to Benzene, bis[(trimethoxysilyl)ethyl] (CAS: 266317...

266317-71-9Benzene, bis[(trimet...