Compound Q&A

What industries use Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2)?

Answer

Cecropin A (1-7)-Melittin A (2-9) amide
Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2) is used in various industries, particularly in pharmaceuticals for its antimicrobial properties. It is also explored in polymer science for its potential to enhance material properties, and in biotechnology for its role in biosensors and semiconductors.

About

English Name Cecropin A (1-7)-Melittin A (2-9) amide
Molecular Formula C89H152N22O15
Molecular Weight 1770.3 g/mol
SMILES CCC(C)C(C(=O)NCC(=O)NC(C)C(=O)NC(C(C)C)C(=O)NC(CC(C)C)C(=O)NC(CCCCN)C(=O)NC(C(C)C)C(=O)NC(CC(C)C)C(=O)N)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(CC1=CC=CC=C1)NC(=O)C(CC(C)C)NC(=O)C(CCCCN)NC(=O)C(CC2=CNC3=CC=CC=C32)NC(=O)C(CCCCN)N
InChIKey WMTUWZOBAVPERW-VZYQMWHSSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2)?

Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2) is a peptide compound known for its cryst...

Compound Q&A

How is Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2) typically synthesized?

Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2) is typically synthesized through solid-ph...

Compound Q&A

What precautions should be taken when handling Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2)?

When handling Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2), it is essential to use per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...