Compound Q&A

How is Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2) typically synthesized?

Answer

Cecropin A (1-7)-Melittin A (2-9) amide
Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2) is typically synthesized through solid-phase peptide synthesis (SPPS) using Fmoc chemistry. Commonly, the synthesis involves protecting groups, coupling reactions, and deprotection steps. The product is then purified and characterized to ensure high selectivity and yield.

About

English Name Cecropin A (1-7)-Melittin A (2-9) amide
Molecular Formula C89H152N22O15
Molecular Weight 1770.3 g/mol
SMILES CCC(C)C(C(=O)NCC(=O)NC(C)C(=O)NC(C(C)C)C(=O)NC(CC(C)C)C(=O)NC(CCCCN)C(=O)NC(C(C)C)C(=O)NC(CC(C)C)C(=O)N)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(CC1=CC=CC=C1)NC(=O)C(CC(C)C)NC(=O)C(CCCCN)NC(=O)C(CC2=CNC3=CC=CC=C32)NC(=O)C(CCCCN)N
InChIKey WMTUWZOBAVPERW-VZYQMWHSSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2)?

Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2) is a peptide compound known for its cryst...

Compound Q&A

What industries use Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2)?

Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2) is used in various industries, particular...

Compound Q&A

What precautions should be taken when handling Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2)?

When handling Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2), it is essential to use per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...