Compound Q&A

What are the physical and chemical properties of Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2)?

Answer

Cecropin A (1-7)-Melittin A (2-9) amide
Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2) is a peptide compound known for its crystalline form. It has a molecular weight of approximately 2,315.5 g/mol and is soluble in water. The compound is known for its antimicrobial and cytotoxic properties. It is reactive towards various proteins and can form stable amide bonds under mild conditions.

About

English Name Cecropin A (1-7)-Melittin A (2-9) amide
Molecular Formula C89H152N22O15
Molecular Weight 1770.3 g/mol
SMILES CCC(C)C(C(=O)NCC(=O)NC(C)C(=O)NC(C(C)C)C(=O)NC(CC(C)C)C(=O)NC(CCCCN)C(=O)NC(C(C)C)C(=O)NC(CC(C)C)C(=O)N)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(CC1=CC=CC=C1)NC(=O)C(CC(C)C)NC(=O)C(CCCCN)NC(=O)C(CC2=CNC3=CC=CC=C32)NC(=O)C(CCCCN)N
InChIKey WMTUWZOBAVPERW-VZYQMWHSSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

How is Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2) typically synthesized?

Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2) is typically synthesized through solid-ph...

Compound Q&A

What industries use Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2)?

Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2) is used in various industries, particular...

Compound Q&A

What precautions should be taken when handling Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2)?

When handling Cecropin A (1-7)-Melittin A (2-9) amide (CAS: 157606-25-2), it is essential to use per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...