Compound Q&A

What industries use Diethyl (4-formylphenyl)phosphonate (CAS: 72436-45-4)?

Answer

Diethyl (4-formylphenyl)phosphonate
Diethyl (4-formylphenyl)phosphonate is used in the pharmaceutical industry for the synthesis of certain drugs, in polymer chemistry for modifying properties of organic materials, in sensor technology for detection applications, and in semiconductor manufacturing for etching processes. Its versatility in organic synthesis makes it valuable across multiple sectors.

About

CAS No 72436-45-4
English Name Diethyl (4-formylphenyl)phosphonate
Molecular Formula C11H15O4P
Molecular Weight 242.21 g/mol
SMILES CCOP(=O)(C1=CC=C(C=C1)C=O)OCC
InChIKey KQJAWWYLJCTQNG-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyl (4-formylphenyl)phosphonate (CAS: 72436-45-4)?

Diethyl (4-formylphenyl)phosphonate is a colorless or pale yellow liquid with a molecular weight of ...

Compound Q&A

How is Diethyl (4-formylphenyl)phosphonate (CAS: 72436-45-4) typically synthesized?

Diethyl (4-formylphenyl)phosphonate is typically synthesized by the reaction of diethyl phosphite wi...

Compound Q&A

What precautions should be taken when handling Diethyl (4-formylphenyl)phosphonate (CAS: 72436-45-4)?

When handling Diethyl (4-formylphenyl)phosphonate, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...