Compound Q&A

What are the physical and chemical properties of Diethyl (4-formylphenyl)phosphonate (CAS: 72436-45-4)?

Answer

Diethyl (4-formylphenyl)phosphonate
Diethyl (4-formylphenyl)phosphonate is a colorless or pale yellow liquid with a molecular weight of approximately 241.24 g/mol. It is slightly soluble in water but highly soluble in organic solvents. The compound is known for its reactivity, particularly towards nucleophiles and bases, making it useful in various chemical reactions. It crystallizes in the orthorhombic system at room temperature.

About

CAS No 72436-45-4
English Name Diethyl (4-formylphenyl)phosphonate
Molecular Formula C11H15O4P
Molecular Weight 242.21 g/mol
SMILES CCOP(=O)(C1=CC=C(C=C1)C=O)OCC
InChIKey KQJAWWYLJCTQNG-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

How is Diethyl (4-formylphenyl)phosphonate (CAS: 72436-45-4) typically synthesized?

Diethyl (4-formylphenyl)phosphonate is typically synthesized by the reaction of diethyl phosphite wi...

Compound Q&A

What industries use Diethyl (4-formylphenyl)phosphonate (CAS: 72436-45-4)?

Diethyl (4-formylphenyl)phosphonate is used in the pharmaceutical industry for the synthesis of cert...

Compound Q&A

What precautions should be taken when handling Diethyl (4-formylphenyl)phosphonate (CAS: 72436-45-4)?

When handling Diethyl (4-formylphenyl)phosphonate, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...