Compound Q&A

What industries use Salmon calcitonin (8-32) reduced (CAS: 151804-77-2)?

Answer

Salmon calcitonin (8-32) reduced
Salmon calcitonin (8-32) reduced is primarily used in the pharmaceutical industry. It serves as an active pharmaceutical ingredient (API) in medications aimed at treating osteoporosis and hypercalcemia. The compound is also of interest in biotechnology and research settings, where it is used for its potential therapeutic benefits and for studying calcium homeostasis mechanisms.

About

English Name Salmon calcitonin (8-32) reduced
Molecular Formula C127H205N37O40
Molecular Weight 2890.2 g/mol
SMILES CC(C)CC(C(=O)NC(CCC(=O)N)C(=O)NC(C(C)O)C(=O)NC(CC1=CC=C(C=C1)O)C(=O)N2CCCC2C(=O)NC(CCCNC(=N)N)C(=O)NC(C(C)O)C(=O)NC(CC(=O)N)C(=O)NC(C(C)O)C(=O)NCC(=O)NC(CO)C(=O)NC(CC(=O)N)C(=O)NC(C(C)O)C(=O)NC(CC3=CC=C(C=C3)O)C(=O)N)NC(=O)C(CCCCN)NC(=O)C(CC4=CNC=N4)NC(=O)C(CC(C)C)NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)N)NC(=O)C(CO)NC(=O)C(CC(C)C)NC(=O)C(CCCCN)NC(=O)CNC(=O)C(CC(C)C)NC(=O)C(C(C)C)NC(=O)C
InChIKey ZLFXHYNEZYAYPG-AABHONRUSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Salmon calcitonin (8-32) reduced (CAS: 151804-77-2)?

Salmon calcitonin (8-32) reduced is a peptide with a molecular weight of approximately 1,054 Da. It ...

Compound Q&A

How is Salmon calcitonin (8-32) reduced (CAS: 151804-77-2) typically synthesized?

Salmon calcitonin (8-32) reduced is synthesized through solid-phase peptide synthesis. The process i...

Compound Q&A

What precautions should be taken when handling Salmon calcitonin (8-32) reduced (CAS: 151804-77-2)?

When handling Salmon calcitonin (8-32) reduced, it is essential to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...