Compound Q&A

How is Salmon calcitonin (8-32) reduced (CAS: 151804-77-2) typically synthesized?

Answer

Salmon calcitonin (8-32) reduced
Salmon calcitonin (8-32) reduced is synthesized through solid-phase peptide synthesis. The process involves the stepwise addition of amino acids to a growing peptide chain using a protected amino terminal approach. The N-terminal residue is protected, and the synthesis proceeds from the C-terminus. The final peptide is then cleaved from the resin and deprotected, yielding the reduced form. Commonly used protecting groups include Fmoc and Boc, and the synthesis typically achieves high yields and good purity.

About

English Name Salmon calcitonin (8-32) reduced
Molecular Formula C127H205N37O40
Molecular Weight 2890.2 g/mol
SMILES CC(C)CC(C(=O)NC(CCC(=O)N)C(=O)NC(C(C)O)C(=O)NC(CC1=CC=C(C=C1)O)C(=O)N2CCCC2C(=O)NC(CCCNC(=N)N)C(=O)NC(C(C)O)C(=O)NC(CC(=O)N)C(=O)NC(C(C)O)C(=O)NCC(=O)NC(CO)C(=O)NC(CC(=O)N)C(=O)NC(C(C)O)C(=O)NC(CC3=CC=C(C=C3)O)C(=O)N)NC(=O)C(CCCCN)NC(=O)C(CC4=CNC=N4)NC(=O)C(CC(C)C)NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)N)NC(=O)C(CO)NC(=O)C(CC(C)C)NC(=O)C(CCCCN)NC(=O)CNC(=O)C(CC(C)C)NC(=O)C(C(C)C)NC(=O)C
InChIKey ZLFXHYNEZYAYPG-AABHONRUSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Salmon calcitonin (8-32) reduced (CAS: 151804-77-2)?

Salmon calcitonin (8-32) reduced is a peptide with a molecular weight of approximately 1,054 Da. It ...

Compound Q&A

What industries use Salmon calcitonin (8-32) reduced (CAS: 151804-77-2)?

Salmon calcitonin (8-32) reduced is primarily used in the pharmaceutical industry. It serves as an a...

Compound Q&A

What precautions should be taken when handling Salmon calcitonin (8-32) reduced (CAS: 151804-77-2)?

When handling Salmon calcitonin (8-32) reduced, it is essential to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...