Compound Q&A

What are the physical and chemical properties of Salmon calcitonin (8-32) reduced (CAS: 151804-77-2)?

Answer

Salmon calcitonin (8-32) reduced
Salmon calcitonin (8-32) reduced is a peptide with a molecular weight of approximately 1,054 Da. It is a solid with a white or off-white crystalline form. The compound is soluble in water and somewhat less soluble in organic solvents. It exhibits moderate reactivity with basic substances and is stable under neutral conditions. This peptide is typically used in pharmaceutical applications and has a relatively stable nature at room temperature and in aqueous solutions.

About

English Name Salmon calcitonin (8-32) reduced
Molecular Formula C127H205N37O40
Molecular Weight 2890.2 g/mol
SMILES CC(C)CC(C(=O)NC(CCC(=O)N)C(=O)NC(C(C)O)C(=O)NC(CC1=CC=C(C=C1)O)C(=O)N2CCCC2C(=O)NC(CCCNC(=N)N)C(=O)NC(C(C)O)C(=O)NC(CC(=O)N)C(=O)NC(C(C)O)C(=O)NCC(=O)NC(CO)C(=O)NC(CC(=O)N)C(=O)NC(C(C)O)C(=O)NC(CC3=CC=C(C=C3)O)C(=O)N)NC(=O)C(CCCCN)NC(=O)C(CC4=CNC=N4)NC(=O)C(CC(C)C)NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)N)NC(=O)C(CO)NC(=O)C(CC(C)C)NC(=O)C(CCCCN)NC(=O)CNC(=O)C(CC(C)C)NC(=O)C(C(C)C)NC(=O)C
InChIKey ZLFXHYNEZYAYPG-AABHONRUSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is Salmon calcitonin (8-32) reduced (CAS: 151804-77-2) typically synthesized?

Salmon calcitonin (8-32) reduced is synthesized through solid-phase peptide synthesis. The process i...

Compound Q&A

What industries use Salmon calcitonin (8-32) reduced (CAS: 151804-77-2)?

Salmon calcitonin (8-32) reduced is primarily used in the pharmaceutical industry. It serves as an a...

Compound Q&A

What precautions should be taken when handling Salmon calcitonin (8-32) reduced (CAS: 151804-77-2)?

When handling Salmon calcitonin (8-32) reduced, it is essential to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...