Compound Q&A

What industries use (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid (CAS: 181227-46-3)?

Answer

(R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid
(R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid is primarily used in the pharmaceutical industry for the synthesis of biologically active compounds. It also finds applications in polymer science for the development of functional materials and in the electronics industry for semiconductor fabrication. Additionally, it is used in the production of sensors and other advanced materials.

About

English Name (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid
Molecular Formula C11H13NO2
Molecular Weight 191.23 g/mol
SMILES C1C(CC2=CC=CC=C21)C(C(=O)O)N
InChIKey GUDHMDVRURNAHL-SNVBAGLBSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid (CAS: 181227-46-3)?

(R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid is a chiral compound with a molecular weight of...

Compound Q&A

How is (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid (CAS: 181227-46-3) typically synthesized?

(R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid can be synthesized through a multi-step process...

Compound Q&A

What precautions should be taken when handling (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid (CAS: 181227-46-3)?

When handling (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid, it is important to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...