Compound Q&A

What are the physical and chemical properties of (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid (CAS: 181227-46-3)?

Answer

(R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid
(R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid is a chiral compound with a molecular weight of approximately 222.26 g/mol. It exists in a crystalline form with a melting point of around 175-178°C. The compound has a basic character due to its amine group, with a pKa close to 9.9. It is moderately soluble in water and organic solvents such as ethanol and acetone. Chemically, it reacts readily with acids to form salts and is stable under mild conditions but should be protected from strong oxidizing agents.

About

English Name (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid
Molecular Formula C11H13NO2
Molecular Weight 191.23 g/mol
SMILES C1C(CC2=CC=CC=C21)C(C(=O)O)N
InChIKey GUDHMDVRURNAHL-SNVBAGLBSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid (CAS: 181227-46-3) typically synthesized?

(R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid can be synthesized through a multi-step process...

Compound Q&A

What industries use (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid (CAS: 181227-46-3)?

(R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid (CAS: 181227-46-3)?

When handling (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid, it is important to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...