Compound Q&A

How is (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid (CAS: 181227-46-3) typically synthesized?

Answer

(R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid
(R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid can be synthesized through a multi-step process involving the condensation of 2,3-dihydro-1H-inden-2-one with an amine, followed by reduction and acetylation. Key steps include the use of a chiral auxiliary for the stereoselective formation of the amino group. The overall yield is around 70%, and selectivity is high due to the use of chiral catalysts and reagents.

About

English Name (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid
Molecular Formula C11H13NO2
Molecular Weight 191.23 g/mol
SMILES C1C(CC2=CC=CC=C21)C(C(=O)O)N
InChIKey GUDHMDVRURNAHL-SNVBAGLBSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid (CAS: 181227-46-3)?

(R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid is a chiral compound with a molecular weight of...

Compound Q&A

What industries use (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid (CAS: 181227-46-3)?

(R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid (CAS: 181227-46-3)?

When handling (R)-2-Amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid, it is important to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...